Kekebrown1 Kekebrown1
  • 13-03-2016
  • Chemistry
contestada

Write a brief desperation for each of newtons three laws

Respuesta :

al98 al98
  • 13-03-2016
1st law: law of inertia, an object will remain stationary unless a force acts upon it.
2nd law: law of acceleration: the momentum experienced by an object is proportional to the size and direction of the force.
3rd law: law of action and reaction: for every action there is an equal and opposite reaction.
Answer Link

Otras preguntas

does personality change over time short essay
cosec(6b+pi/8)=sec(2b-pi/8)​
how does the size od the senate affect its operation ​
What is the function of NADPH and ATP in the Calvin cycle? • A They provide the energy required to build high-energy sugars B. They provide the energy to create
Are there any organisms that do not have tissue structures? Yes or no?
A line that includes the points (6,h) and (7,−10) has a slope of −7. ​ ​ What is the value of h ? ​
A batter hits the a baseball so that it leaves the bat with an initial speed 37mps at an angle of 53degree find the position of ball after 2 second
how may weeks are there in a year?​
There are 6 number cards (-4,-2,-1 ,5, 6, 8) arrange the cards into three pairs with the same total
Which quotation from the text best develops the central idea that the narrator recognizes that he was meant to have a career in medicine?​ What is the central i