audawnt audawnt

13-02-2020
Mathematics

contestada

Cos(2x)cos(x)+sin(2x)sin(x)=1

Respuesta :

melkemk503 melkemk503

13-02-2020

Answer:

=cos(x) use basic properties of sosine (addition and subtraction) cos(a-b)=cos(a)cos(b)+sin(a)sin(b)

Answer Link

Otras preguntas

Throughout the story the narrator uses the words “creep” and “creeping” to describe the wallpaper figure’s movements. What does this word choice suggest about t

Which of the following distinguishes the isotope mercury-196 from the isotope mercury-199? A. number of neutrons in the nucleus B. Location on the periodic ta

Which is an example of a high-risk investment? stock in a start-up company bond CDs from an insured bank 401(k)

Raphael is called the “father of the oil painting.” true or false

What impact does point of view have on the gift of Magi explain how the story would be different if told from the first person point of view

Is this sentence grammatically correct? De quelle voiture parles-tu?

NS bisects QNR, what is m QNR if m QNS= 48?

Darby is reading a book for school. She read 4 10 of the book last week and 2 10 of the book this week. How much of the book does Darby have left to read?

The circumference of a circle is 20π cm. What is the DIAMETER of the circle? A) 4 cm B) 5 cm C) 10 cm D) 20 cm

why would a writer select one organizational structure over the other ?