walkerjahdaya walkerjahdaya

14-03-2021
Mathematics

contestada

Explain how you can find the area of a figure that is formed by several same-size circles.

Respuesta :

arielleyva4 arielleyva4

14-03-2021

Pie times R squared or 3.14 x r ^2

Answer Link

samanthaennin samanthaennin

15-03-2021

Pie times R squared

Answer Link

Otras preguntas

Find vertex of y=3x^2+18x+30

Show that cos(A+45)=cos45(cosA-sinA)

a vertical line goes through the points (6,-5). Someone plzzzz tell me what are the coordinates of the vertical line and how do u solve this problem? ???

Could someone help me to fill these blank spaces? 1830 Congress passes the Indian ____________ Act. 1832 The Supreme _______________ overturns the act. 1832 Bot

Was colonial involvement a positive development for Latin America on balance, or a negative one? Write a well-organized persuasive essay on the merits and drawb

Which symbol is used for an alpha particle? a. β c. γ b. Δ d. α

what are all of the proper units of weight in the metric system.

Jared has 5 more bouncy balls than Brenna. Brenna has b bouncy balls. Write an expression that shows how many bouncy balls Jared has. Type an asterisk ( * ) if

PLEASE HELP ME! Was colonial involvement a positive development for Latin America on balance, or a negative one? Write a well-organized persuasive essay on the

An amusement park in Orlando, Florida, has an iconic spherical structure at its entrance. The diameter of the structure is 165 ft. What is the approximate volum