taygab20 taygab20

14-03-2017
History

contestada

what did Roosevelt believe was the key to world peace

Respuesta :

amelia18 amelia18

14-03-2017

The answer is economic growth .

Answer Link

Otras preguntas

Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl

-50 POINTS- please help

What countries compromised the triple entente

!50 POINTS! GIVE REAL ANSWER OR I REPORT PLZ NO TROLLS! An executive drove from his home at an average speed of 35 mph to an airport where a helicopter was wait

At the beginning of 2019, Emily Corporation issued 10,000 shares of $100 par, 5%, cumulative, preferred stock for $110 per share. No dividends have been paid to

DEF Company is incorporating and coming to market with an initial public offering of common stock. The company has already filed their registration statement an

Create a figure with half the perimeter of a given figure. you don't have to actually make a shape, can someone explain how to do this pls

Men are more likely than women to be diagnosed with ________________ disorders. Anxiety substance use mood schizophrenia

Question #2: Is this a SENTENCE? Lost their footing and fell. A.Yes B.No

what is mean absolute deviation (MAD) and how do I find it?