lopezwilsonwl4p43hyq lopezwilsonwl4p43hyq

12-03-2018
History

contestada

Why gave rise to the slave trade?

Respuesta :

Аноним Аноним

12-03-2018

It was an triangular trade operated by ships carrying European manufactures ans exchanged them for enslaved Africans

Answer Link

Otras preguntas

You're conducting an experiment on another planet. You drop a rock from a height of 1 m and it hits the ground 0.4 seconds later. What is acceleration due to gr

If the sample size is increased and the standard deviation and confidence level stay the same, then the margin of error will also be increased. a. True b. False

Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl

modern humans first appeared about __ years ago

John manufactures household furniture. His start-up costs, including tools, plans, and advertising, total \$5000$5000dollar sign, 5000. Labor and materials for

Great Society reforms:_________. a) grew in popularity over the next decade. b) were generally proven to be cost-effective. c) made no dent in reducing hunger i

How does this image enhance the information providedin the book?o It connects the book's central ideas about bicycleinnovators.It offers an example of how the A

70 points! Please answer fast!

Holiday Laboratories purchased a high-speed industrial centrifuge at a cost of $460,000. Shipping costs totaled $11,000. Foundation work to house the centrifuge

songs for East Africa's association officials